C15H18F3NO4S — CID 68644141
[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]methyl acetate (PubChem CID 68644141) has the molecular formula C15H18F3NO4S and a molecular weight of 365.37 g/mol. Its IUPAC name is [1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]methyl acetate.
| Compound Name | [1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68644141 |
| Molecular Formula | C15H18F3NO4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCCCN1S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO4S/c1-11(20)23-10-12-6-4-5-9-19(12)24(21,22)14-8-3-2-7-13(14)15(16,17)18/h2-3,7-8,12H,4-6,9-10H2,1H3 |
| InChIKey | PKKOTTGHUDBVSR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |