C15H17F3N2O5S — CID 2484237
(2-amino-2-oxoethyl) 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 2484237) has the molecular formula C15H17F3N2O5S and a molecular weight of 394.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 2484237 |
| Molecular Formula | C15H17F3N2O5S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | NC(=O)COC(=O)C1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H17F3N2O5S/c16-15(17,18)11-3-1-2-4-12(11)26(23,24)20-7-5-10(6-8-20)14(22)25-9-13(19)21/h1-4,10H,5-9H2,(H2,19,21) |
| InChIKey | PIBMENPKCIMCMT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |