C21H22F3NO4S — CID 26181530
[(1S)-1-phenylethyl] 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 26181530) has the molecular formula C21H22F3NO4S and a molecular weight of 441.47 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | [(1S)-1-phenylethyl] 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 26181530 |
| Molecular Formula | C21H22F3NO4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [(1S)-1-phenylethyl] 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | C[C@H](OC(=O)C1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H22F3NO4S/c1-15(16-7-3-2-4-8-16)29-20(26)17-11-13-25(14-12-17)30(27,28)19-10-6-5-9-18(19)21(22,23)24/h2-10,15,17H,11-14H2,1H3/t15-/m0/s1 |
| InChIKey | UXZPNKMZMIQAOO-HNNXBMFYSA-N |
| XLogP | 4.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |