C19H20F3NO3S — CID 97000881
(2S)-2-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine (PubChem CID 97000881) has the molecular formula C19H20F3NO3S and a molecular weight of 399.43 g/mol. Its IUPAC name is (2S)-2-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine.
| Compound Name | (2S)-2-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 97000881 |
| Molecular Formula | C19H20F3NO3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2S)-2-[(2-methoxyphenyl)methyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| SMILES | COc1ccccc1C[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO3S/c1-26-17-10-4-2-7-14(17)13-15-8-6-12-23(15)27(24,25)18-11-5-3-9-16(18)19(20,21)22/h2-5,7,9-11,15H,6,8,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | AJFQNHVYQHNSCQ-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |