C12H11F3NO4S- — CID 2384446
(2R)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 2384446) has the molecular formula C12H11F3NO4S- and a molecular weight of 322.28 g/mol. Its IUPAC name is (2R)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2384446 |
| Molecular Formula | C12H11F3NO4S- |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (2R)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4S/c13-12(14,15)8-4-1-2-6-10(8)21(19,20)16-7-3-5-9(16)11(17)18/h1-2,4,6,9H,3,5,7H2,(H,17,18)/p-1/t9-/m1/s1 |
| InChIKey | GIXSYXMUHHKVPS-SECBINFHSA-M |
| XLogP | 0.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |