C15H13ClNO4S- — CID 7201386
(2R)-1-(8-chloronaphthalen-1-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 7201386) has the molecular formula C15H13ClNO4S- and a molecular weight of 338.79 g/mol. Its IUPAC name is (2R)-1-(8-chloronaphthalen-1-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-(8-chloronaphthalen-1-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7201386 |
| Molecular Formula | C15H13ClNO4S- |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (2R)-1-(8-chloronaphthalen-1-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN1S(=O)(=O)c1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C15H14ClNO4S/c16-11-6-1-4-10-5-2-8-13(14(10)11)22(20,21)17-9-3-7-12(17)15(18)19/h1-2,4-6,8,12H,3,7,9H2,(H,18,19)/p-1/t12-/m1/s1 |
| InChIKey | KEQKJKJZWCBCFD-GFCCVEGCSA-M |
| XLogP | 1.40 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |