C18H18ClNO3S — CID 129367282
[(2S)-1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylphenyl)methanone (PubChem CID 129367282) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is [(2S)-1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [(2S)-1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 129367282 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [(2S)-1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@@H]2CCCN2S(=O)(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO3S/c1-13-8-10-14(11-9-13)18(21)16-6-4-12-20(16)24(22,23)17-7-3-2-5-15(17)19/h2-3,5,7-11,16H,4,6,12H2,1H3/t16-/m0/s1 |
| InChIKey | LTMXACSQORGCIE-INIZCTEOSA-N |
| XLogP | 3.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |