C17H19N2O4S- — CID 6921745
(2R)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 6921745) has the molecular formula C17H19N2O4S- and a molecular weight of 347.42 g/mol. Its IUPAC name is (2R)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6921745 |
| Molecular Formula | C17H19N2O4S- |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2R)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N3CCC[C@@H]3C(=O)[O-])cccc12 |
| InChI | InChI=1S/C17H20N2O4S/c1-18(2)14-8-3-7-13-12(14)6-4-10-16(13)24(22,23)19-11-5-9-15(19)17(20)21/h3-4,6-8,10,15H,5,9,11H2,1-2H3,(H,20,21)/p-1/t15-/m1/s1 |
| InChIKey | ZHJIWURDCGMVQE-OAHLLOKOSA-M |
| XLogP | 0.81 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |