C16H20N4O3S — CID 10383124
N,N-dimethyl-5-(4-nitrosopiperazin-1-yl)sulfonylnaphthalen-1-amine (PubChem CID 10383124) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N,N-dimethyl-5-(4-nitrosopiperazin-1-yl)sulfonylnaphthalen-1-amine.
| Compound Name | N,N-dimethyl-5-(4-nitrosopiperazin-1-yl)sulfonylnaphthalen-1-amine |
|---|---|
| PubChem CID | 10383124 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N,N-dimethyl-5-(4-nitrosopiperazin-1-yl)sulfonylnaphthalen-1-amine |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N3CCN(N=O)CC3)cccc12 |
| InChI | InChI=1S/C16H20N4O3S/c1-18(2)15-7-3-6-14-13(15)5-4-8-16(14)24(22,23)20-11-9-19(17-21)10-12-20/h3-8H,9-12H2,1-2H3 |
| InChIKey | UIJBXBJUPKDQDN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|