C18H22N2O4S — CID 123787937
1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 123787937) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 123787937 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N3CCCCC3C(=O)O)cccc12 |
| InChI | InChI=1S/C18H22N2O4S/c1-19(2)15-10-5-8-14-13(15)7-6-11-17(14)25(23,24)20-12-4-3-9-16(20)18(21)22/h5-8,10-11,16H,3-4,9,12H2,1-2H3,(H,21,22) |
| InChIKey | GPKVHXBHFHFEJZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |