C14H19NO4S — CID 40516561
(2R)-1-(2,5-dimethylphenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 40516561) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (2R)-1-(2,5-dimethylphenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2R)-1-(2,5-dimethylphenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 40516561 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2R)-1-(2,5-dimethylphenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-6-7-11(2)13(9-10)20(18,19)15-8-4-3-5-12(15)14(16)17/h6-7,9,12H,3-5,8H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | BFJNRCKIPBACCU-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |