C17H24NO4S- — CID 2473314
(2S)-1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 2473314) has the molecular formula C17H24NO4S- and a molecular weight of 338.45 g/mol. Its IUPAC name is (2S)-1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | (2S)-1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 2473314 |
| Molecular Formula | C17H24NO4S- |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2S)-1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C17H25NO4S/c1-12-8-9-13(17(2,3)4)11-15(12)23(21,22)18-10-6-5-7-14(18)16(19)20/h8-9,11,14H,5-7,10H2,1-4H3,(H,19,20)/p-1/t14-/m0/s1 |
| InChIKey | OPIWVVLHJDYWEA-AWEZNQCLSA-M |
| XLogP | 1.59 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |