C17H25NO4S — CID 3943095
1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 3943095) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3943095 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(5-tert-butyl-2-methylphenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C17H25NO4S/c1-12-8-9-13(17(2,3)4)11-15(12)23(21,22)18-10-6-5-7-14(18)16(19)20/h8-9,11,14H,5-7,10H2,1-4H3,(H,19,20) |
| InChIKey | OPIWVVLHJDYWEA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |