C12H13ClN2O5S — CID 146131026
4-[(2R)-2-carbamoylpyrrolidin-1-yl]sulfonyl-3-chlorobenzoic acid (PubChem CID 146131026) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is 4-[(2R)-2-carbamoylpyrrolidin-1-yl]sulfonyl-3-chlorobenzoic acid.
| Compound Name | 4-[(2R)-2-carbamoylpyrrolidin-1-yl]sulfonyl-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 146131026 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-[(2R)-2-carbamoylpyrrolidin-1-yl]sulfonyl-3-chlorobenzoic acid |
| SMILES | NC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O5S/c13-8-6-7(12(17)18)3-4-10(8)21(19,20)15-5-1-2-9(15)11(14)16/h3-4,6,9H,1-2,5H2,(H2,14,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | SUBCJZDVYZVZOU-SECBINFHSA-N |
| XLogP | 0.68 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |