C21H27FN2O5S — CID 16730453
4-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]morpholine-3-carboxamide (PubChem CID 16730453) has the molecular formula C21H27FN2O5S and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]morpholine-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 16730453 |
| Molecular Formula | C21H27FN2O5S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]morpholine-3-carboxamide |
| SMILES | O=C(NC1[C@@H]2CC3C[C@H]1CC(O)(C3)C2)C1COCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O5S/c22-16-1-3-17(4-2-16)30(27,28)24-5-6-29-12-18(24)20(25)23-19-14-7-13-8-15(19)11-21(26,9-13)10-14/h1-4,13-15,18-19,26H,5-12H2,(H,23,25)/t13?,14-,15+,18?,19?,21? |
| InChIKey | AKMNTFQUKXLHLR-GLFNZEPASA-N |
| XLogP | 1.27 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |