C21H29N3O4S — CID 24955047
N-(5-hydroxy-2-adamantyl)-1-pyridin-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 24955047) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-1-pyridin-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-1-pyridin-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24955047 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-1-pyridin-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)C1CCN(S(=O)(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C21H29N3O4S/c25-20(23-19-16-9-14-10-17(19)13-21(26,11-14)12-16)15-4-7-24(8-5-15)29(27,28)18-3-1-2-6-22-18/h1-3,6,14-17,19,26H,4-5,7-13H2,(H,23,25) |
| InChIKey | PWVITUUKMYNQSU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |