C23H33N3O4S — CID 24954685
N-(5-hydroxy-2-adamantyl)-1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxamide (PubChem CID 24954685) has the molecular formula C23H33N3O4S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24954685 |
| Molecular Formula | C23H33N3O4S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)C1CCN(S(=O)(=O)CCc2ccccn2)CC1 |
| InChI | InChI=1S/C23H33N3O4S/c27-22(25-21-18-11-16-12-19(21)15-23(28,13-16)14-18)17-4-8-26(9-5-17)31(29,30)10-6-20-3-1-2-7-24-20/h1-3,7,16-19,21,28H,4-6,8-15H2,(H,25,27) |
| InChIKey | JUJUQZOMDFYVEJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |