C26H32N4O2 — CID 54591981
N-(5-hydroxy-2-adamantyl)-6-(4-pyridin-2-ylpiperidin-1-yl)pyridine-2-carboxamide (PubChem CID 54591981) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-6-(4-pyridin-2-ylpiperidin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-6-(4-pyridin-2-ylpiperidin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54591981 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-6-(4-pyridin-2-ylpiperidin-1-yl)pyridine-2-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)c1cccc(N2CCC(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C26H32N4O2/c31-25(29-24-19-12-17-13-20(24)16-26(32,14-17)15-19)22-5-3-6-23(28-22)30-10-7-18(8-11-30)21-4-1-2-9-27-21/h1-6,9,17-20,24,32H,7-8,10-16H2,(H,29,31) |
| InChIKey | GPTUKFNMFWMSHR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |