C28H35N3O3 — CID 54591134
N-(5-hydroxy-2-adamantyl)-6-[4-(4-methoxyphenyl)piperidin-1-yl]pyridine-2-carboxamide (PubChem CID 54591134) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-6-[4-(4-methoxyphenyl)piperidin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-6-[4-(4-methoxyphenyl)piperidin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54591134 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-6-[4-(4-methoxyphenyl)piperidin-1-yl]pyridine-2-carboxamide |
| SMILES | COc1ccc(C2CCN(c3cccc(C(=O)NC4C5CC6CC4CC(O)(C6)C5)n3)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O3/c1-34-23-7-5-19(6-8-23)20-9-11-31(12-10-20)25-4-2-3-24(29-25)27(32)30-26-21-13-18-14-22(26)17-28(33,15-18)16-21/h2-8,18,20-22,26,33H,9-17H2,1H3,(H,30,32) |
| InChIKey | PNGUAUIGKYRUEW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |