C30H38N4O3 — CID 67463119
N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-(1-hydroxycyclopropyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide (PubChem CID 67463119) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-(1-hydroxycyclopropyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-(1-hydroxycyclopropyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67463119 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-(1-hydroxycyclopropyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(C3(O)CC3)cc2)CCN1c1cccc(C(=O)NC2C3CC4CC2CC(O)(C4)C3)n1 |
| InChI | InChI=1S/C30H38N4O3/c1-19-18-33(24-7-5-23(6-8-24)30(37)9-10-30)11-12-34(19)26-4-2-3-25(31-26)28(35)32-27-21-13-20-14-22(27)17-29(36,15-20)16-21/h2-8,19-22,27,36-37H,9-18H2,1H3,(H,32,35)/t19-,20?,21?,22?,27?,29?/m1/s1 |
| InChIKey | RCSGSCSVGBGYCM-ADYOOULISA-N |
| XLogP | 3.45 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|