C28H34N4O3 — CID 67468209
6-[4-(4-carbamoylphenyl)piperidin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide (PubChem CID 67468209) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 6-[4-(4-carbamoylphenyl)piperidin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide.
| Compound Name | 6-[4-(4-carbamoylphenyl)piperidin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67468209 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 6-[4-(4-carbamoylphenyl)piperidin-1-yl]-N-(5-hydroxy-2-adamantyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(C2CCN(c3cccc(C(=O)NC4C5CC6CC4CC(O)(C6)C5)n3)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c29-26(33)20-6-4-18(5-7-20)19-8-10-32(11-9-19)24-3-1-2-23(30-24)27(34)31-25-21-12-17-13-22(25)16-28(35,14-17)15-21/h1-7,17,19,21-22,25,35H,8-16H2,(H2,29,33)(H,31,34) |
| InChIKey | MMBSHPNOBVYNMN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |