C23H31ClN2O4S — CID 90643789
(2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)piperidine-2-carboxamide (PubChem CID 90643789) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is (2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)piperidine-2-carboxamide.
| Compound Name | (2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 90643789 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (2R)-1-(3-chloro-2-methylphenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)piperidine-2-carboxamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCCC[C@@H]1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C23H31ClN2O4S/c1-14-18(24)5-4-7-20(14)31(29,30)26-8-3-2-6-19(26)22(27)25-21-16-9-15-10-17(21)13-23(28,11-15)12-16/h4-5,7,15-17,19,21,28H,2-3,6,8-13H2,1H3,(H,25,27)/t15?,16?,17?,19-,21?,23?/m1/s1 |
| InChIKey | QOTYKOONJNXZFD-AWKXOWTNSA-N |
| XLogP | 3.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |