C24H33ClN2O3S — CID 70266745
N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]methyl]adamantane-1-carboxamide (PubChem CID 70266745) has the molecular formula C24H33ClN2O3S and a molecular weight of 465.06 g/mol. Its IUPAC name is N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 70266745 |
| Molecular Formula | C24H33ClN2O3S |
| Molecular Weight | 465.06 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]methyl]adamantane-1-carboxamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCC(CNC(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C24H33ClN2O3S/c1-16-21(25)3-2-4-22(16)31(29,30)27-7-5-17(6-8-27)15-26-23(28)24-12-18-9-19(13-24)11-20(10-18)14-24/h2-4,17-20H,5-15H2,1H3,(H,26,28) |
| InChIKey | JAFDXVFCPHBGSP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.06 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |