C21H27FN2O4S — CID 16730452
1-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]pyrrolidine-2-carboxamide (PubChem CID 16730452) has the molecular formula C21H27FN2O4S and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16730452 |
| Molecular Formula | C21H27FN2O4S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[(1S,3R)-5-hydroxy-2-adamantyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1[C@@H]2CC3C[C@H]1CC(O)(C3)C2)C1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O4S/c22-16-3-5-17(6-4-16)29(27,28)24-7-1-2-18(24)20(25)23-19-14-8-13-9-15(19)12-21(26,10-13)11-14/h3-6,13-15,18-19,26H,1-2,7-12H2,(H,23,25)/t13?,14-,15+,18?,19?,21? |
| InChIKey | GBWSQHNMECABPS-GLFNZEPASA-N |
| XLogP | 2.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |