C24H31FN2O4S — CID 71532689
(2S)-1-(4-fluorophenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)-2-prop-2-enylpyrrolidine-2-carboxamide (PubChem CID 71532689) has the molecular formula C24H31FN2O4S and a molecular weight of 462.59 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)-2-prop-2-enylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-fluorophenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)-2-prop-2-enylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71532689 |
| Molecular Formula | C24H31FN2O4S |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)sulfonyl-N-(5-hydroxy-2-adamantyl)-2-prop-2-enylpyrrolidine-2-carboxamide |
| SMILES | C=CC[C@]1(C(=O)NC2C3CC4CC2CC(O)(C4)C3)CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FN2O4S/c1-2-8-24(9-3-10-27(24)32(30,31)20-6-4-19(25)5-7-20)22(28)26-21-17-11-16-12-18(21)15-23(29,13-16)14-17/h2,4-7,16-18,21,29H,1,3,8-15H2,(H,26,28)/t16?,17?,18?,21?,23?,24-/m1/s1 |
| InChIKey | JIKVZXNKZMMHTA-DFCDEULOSA-N |
| XLogP | 2.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|