C20H26N2O2 — CID 59658107
N-[(1R,3S)-5-hydroxy-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 59658107) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[(1R,3S)-5-hydroxy-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-[(1R,3S)-5-hydroxy-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 59658107 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-[(1R,3S)-5-hydroxy-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NC1[C@@H]2CC3C[C@H]1CC(O)(C3)C2)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H26N2O2/c23-19(22-7-3-5-14-4-1-2-6-17(14)22)21-18-15-8-13-9-16(18)12-20(24,10-13)11-15/h1-2,4,6,13,15-16,18,24H,3,5,7-12H2,(H,21,23)/t13?,15-,16+,18?,20? |
| InChIKey | HNEHWDDCSZJESF-LYLPNMKGSA-N |
| XLogP | 3.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |