C18H26N2O — CID 69221349
N-cycloheptyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide (PubChem CID 69221349) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-cycloheptyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide.
| Compound Name | N-cycloheptyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 69221349 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-cycloheptyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
| SMILES | O=C(NC1CCCCCC1)N1CCCCc2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c21-18(19-16-11-3-1-2-4-12-16)20-14-8-7-10-15-9-5-6-13-17(15)20/h5-6,9,13,16H,1-4,7-8,10-12,14H2,(H,19,21) |
| InChIKey | NGONJNLQPPLFKR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |