C17H22N2O — CID 108911667
N-[(E)-2-cyclopentylethenyl]-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 108911667) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(E)-2-cyclopentylethenyl]-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-[(E)-2-cyclopentylethenyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 108911667 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-[(E)-2-cyclopentylethenyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(N/C=C/C1CCCC1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H22N2O/c20-17(18-12-11-14-6-1-2-7-14)19-13-5-9-15-8-3-4-10-16(15)19/h3-4,8,10-12,14H,1-2,5-7,9,13H2,(H,18,20)/b12-11+ |
| InChIKey | WINWHLICXXIQTQ-VAWYXSNFSA-N |
| XLogP | 3.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |