C18H18N2O2 — CID 69369112
N-benzoyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide (PubChem CID 69369112) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-benzoyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide.
| Compound Name | N-benzoyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 69369112 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-benzoyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
| SMILES | O=C(NC(=O)N1CCCCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c21-17(15-10-2-1-3-11-15)19-18(22)20-13-7-6-9-14-8-4-5-12-16(14)20/h1-5,8,10-12H,6-7,9,13H2,(H,19,21,22) |
| InChIKey | GXQUIRSCPLLOHT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |