C16H13ClN2O2 — CID 23992308
N-(4-chlorobenzoyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 23992308) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is N-(4-chlorobenzoyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(4-chlorobenzoyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 23992308 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(4-chlorobenzoyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(NC(=O)N1CCc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O2/c17-13-7-5-12(6-8-13)15(20)18-16(21)19-10-9-11-3-1-2-4-14(11)19/h1-8H,9-10H2,(H,18,20,21) |
| InChIKey | YCOKOSOQSXOXTR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |