C21H16ClN3O2 — CID 109108143
N-(4-chlorophenyl)-5-(2,3-dihydroindole-1-carbonyl)pyridine-3-carboxamide (PubChem CID 109108143) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(2,3-dihydroindole-1-carbonyl)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-(2,3-dihydroindole-1-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109108143 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(4-chlorophenyl)-5-(2,3-dihydroindole-1-carbonyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cncc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H16ClN3O2/c22-17-5-7-18(8-6-17)24-20(26)15-11-16(13-23-12-15)21(27)25-10-9-14-3-1-2-4-19(14)25/h1-8,11-13H,9-10H2,(H,24,26) |
| InChIKey | YXPIUIVKRRUAFQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |