C19H15ClN4O — CID 109266162
N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide (PubChem CID 109266162) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109266162 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cnc(N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C19H15ClN4O/c20-15-5-7-16(8-6-15)23-18(25)14-11-21-19(22-12-14)24-10-9-13-3-1-2-4-17(13)24/h1-8,11-12H,9-10H2,(H,23,25) |
| InChIKey | BIUVODSEOPROSA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |