C31H41N5O5S — CID 58102042
N-(5-hydroxy-2-adamantyl)-4-[4-[4-(2-hydroxyethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 58102042) has the molecular formula C31H41N5O5S and a molecular weight of 595.77 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-4-[4-[4-(2-hydroxyethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-4-[4-[4-(2-hydroxyethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 58102042 |
| Molecular Formula | C31H41N5O5S |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-4-[4-[4-(2-hydroxyethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)N1CCN(c2ccc(N3CCN(S(=O)(=O)CCO)CC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C31H41N5O5S/c37-15-16-42(40,41)34-11-9-33(10-12-34)25-5-7-26(8-6-25)35-13-14-36(28-4-2-1-3-27(28)35)30(38)32-29-23-17-22-18-24(29)21-31(39,19-22)20-23/h1-8,22-24,29,37,39H,9-21H2,(H,32,38) |
| InChIKey | MTIKPGQCWGTDAJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|