C30H38N4O2 — CID 143862154
N-(2-adamantyl)-4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 143862154) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-(2-adamantyl)-4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | N-(2-adamantyl)-4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 143862154 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | N-(2-adamantyl)-4-[4-(4-hydroxypiperidin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | O=C(NC1C2CC3CC(C2)CC1C3)N1CCN(c2ccc(N3CCC(O)CC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C30H38N4O2/c35-26-9-11-32(12-10-26)24-5-7-25(8-6-24)33-13-14-34(28-4-2-1-3-27(28)33)30(36)31-29-22-16-20-15-21(18-22)19-23(29)17-20/h1-8,20-23,26,29,35H,9-19H2,(H,31,36) |
| InChIKey | TZHFJBGSAILZJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|