C31H39N5O5S — CID 66863284
(3S)-4-[[4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carbonyl]amino]adamantane-1-carboxylic acid (PubChem CID 66863284) has the molecular formula C31H39N5O5S and a molecular weight of 593.75 g/mol. Its IUPAC name is (3S)-4-[[4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carbonyl]amino]adamantane-1-carboxylic acid.
| Compound Name | (3S)-4-[[4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carbonyl]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 66863284 |
| Molecular Formula | C31H39N5O5S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | (3S)-4-[[4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3-dihydroquinoxaline-1-carbonyl]amino]adamantane-1-carboxylic acid |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(N3CCN(C(=O)NC4C5CC6C[C@H]4CC(C(=O)O)(C6)C5)c4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C31H39N5O5S/c1-42(40,41)34-12-10-33(11-13-34)24-6-8-25(9-7-24)35-14-15-36(27-5-3-2-4-26(27)35)30(39)32-28-22-16-21-17-23(28)20-31(18-21,19-22)29(37)38/h2-9,21-23,28H,10-20H2,1H3,(H,32,39)(H,37,38)/t21?,22-,23?,28?,31?/m0/s1 |
| InChIKey | WSNRWZGIOYIYDG-ZTZBHBBQSA-N |
| XLogP | 3.72 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|