C26H32N2O4S — CID 71532441
(2R)-N-(5-hydroxy-2-adamantyl)-2-methyl-1-naphthalen-1-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 71532441) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is (2R)-N-(5-hydroxy-2-adamantyl)-2-methyl-1-naphthalen-1-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(5-hydroxy-2-adamantyl)-2-methyl-1-naphthalen-1-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71532441 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (2R)-N-(5-hydroxy-2-adamantyl)-2-methyl-1-naphthalen-1-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | C[C@]1(C(=O)NC2C3CC4CC2CC(O)(C4)C3)CCCN1S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H32N2O4S/c1-25(24(29)27-23-19-12-17-13-20(23)16-26(30,14-17)15-19)10-5-11-28(25)33(31,32)22-9-4-7-18-6-2-3-8-21(18)22/h2-4,6-9,17,19-20,23,30H,5,10-16H2,1H3,(H,27,29)/t17?,19?,20?,23?,25-,26?/m1/s1 |
| InChIKey | NQOVLMGCDWQSNR-XWKPHWODSA-N |
| XLogP | 3.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |