C12H14N4O4S — CID 114613914
4-[(6-cyano-3-pyridinyl)sulfonyl]-N-methylmorpholine-3-carboxamide (PubChem CID 114613914) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-[(6-cyano-3-pyridinyl)sulfonyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-[(6-cyano-3-pyridinyl)sulfonyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 114613914 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-[(6-cyano-3-pyridinyl)sulfonyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1S(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C12H14N4O4S/c1-14-12(17)11-8-20-5-4-16(11)21(18,19)10-3-2-9(6-13)15-7-10/h2-3,7,11H,4-5,8H2,1H3,(H,14,17) |
| InChIKey | WRCGUBQVLKPHLE-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |