C11H14N4O2S — CID 115752142
5-[3-(methylamino)pyrrolidin-1-yl]sulfonylpyridine-2-carbonitrile (PubChem CID 115752142) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 5-[3-(methylamino)pyrrolidin-1-yl]sulfonylpyridine-2-carbonitrile.
| Compound Name | 5-[3-(methylamino)pyrrolidin-1-yl]sulfonylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115752142 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-[3-(methylamino)pyrrolidin-1-yl]sulfonylpyridine-2-carbonitrile |
| SMILES | CNC1CCN(S(=O)(=O)c2ccc(C#N)nc2)C1 |
| InChI | InChI=1S/C11H14N4O2S/c1-13-10-4-5-15(8-10)18(16,17)11-3-2-9(6-12)14-7-11/h2-3,7,10,13H,4-5,8H2,1H3 |
| InChIKey | NVKFZYGCSKYUDH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |