C12H13N5O3S — CID 115682004
5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)sulfonyl]pyridine-2-carbonitrile (PubChem CID 115682004) has the molecular formula C12H13N5O3S and a molecular weight of 307.33 g/mol. Its IUPAC name is 5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)sulfonyl]pyridine-2-carbonitrile.
| Compound Name | 5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)sulfonyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115682004 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)sulfonyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN3C(=O)NCC3C2)cn1 |
| InChI | InChI=1S/C12H13N5O3S/c13-5-9-1-2-11(7-14-9)21(19,20)16-3-4-17-10(8-16)6-15-12(17)18/h1-2,7,10H,3-4,6,8H2,(H,15,18) |
| InChIKey | YRUMCZGWIBKAEL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |