C11H14N4O2S — CID 113296343
5-(4-aminopiperidin-1-yl)sulfonylpyridine-2-carbonitrile (PubChem CID 113296343) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 5-(4-aminopiperidin-1-yl)sulfonylpyridine-2-carbonitrile.
| Compound Name | 5-(4-aminopiperidin-1-yl)sulfonylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 113296343 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-(4-aminopiperidin-1-yl)sulfonylpyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC(N)CC2)cn1 |
| InChI | InChI=1S/C11H14N4O2S/c12-7-10-1-2-11(8-14-10)18(16,17)15-5-3-9(13)4-6-15/h1-2,8-9H,3-6,13H2 |
| InChIKey | DCVDGKSEOGXLSA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |