C21H19N5O6S — CID 154072344
6-(4-nitrophenyl)sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide (PubChem CID 154072344) has the molecular formula C21H19N5O6S and a molecular weight of 469.48 g/mol. Its IUPAC name is 6-(4-nitrophenyl)sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide.
| Compound Name | 6-(4-nitrophenyl)sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 154072344 |
| Molecular Formula | C21H19N5O6S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 6-(4-nitrophenyl)sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide |
| SMILES | O=C(NOCc1ccccc1)C1Cc2nccnc2CN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N5O6S/c27-21(24-32-14-15-4-2-1-3-5-15)20-12-18-19(23-11-10-22-18)13-25(20)33(30,31)17-8-6-16(7-9-17)26(28)29/h1-11,20H,12-14H2,(H,24,27) |
| InChIKey | KDORKMHBVBGILZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|