C28H29N3O8S — CID 23566991
benzyl 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-4-(4-nitrophenoxy)butanoate (PubChem CID 23566991) has the molecular formula C28H29N3O8S and a molecular weight of 567.62 g/mol. Its IUPAC name is benzyl 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-4-(4-nitrophenoxy)butanoate.
| Compound Name | benzyl 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-4-(4-nitrophenoxy)butanoate |
|---|---|
| PubChem CID | 23566991 |
| Molecular Formula | C28H29N3O8S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | benzyl 2-[[1-(benzenesulfonyl)pyrrolidine-2-carbonyl]amino]-4-(4-nitrophenoxy)butanoate |
| SMILES | O=C(OCc1ccccc1)C(CCOc1ccc([N+](=O)[O-])cc1)NC(=O)C1CCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O8S/c32-27(26-12-7-18-30(26)40(36,37)24-10-5-2-6-11-24)29-25(28(33)39-20-21-8-3-1-4-9-21)17-19-38-23-15-13-22(14-16-23)31(34)35/h1-6,8-11,13-16,25-26H,7,12,17-20H2,(H,29,32) |
| InChIKey | IPUYCMIPODKXKL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|