C20H24N4O7S — CID 85306354
ethyl 4-[4-[[7-(hydroxycarbamoyl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]sulfonyl]phenoxy]butanoate (PubChem CID 85306354) has the molecular formula C20H24N4O7S and a molecular weight of 464.50 g/mol. Its IUPAC name is ethyl 4-[4-[[7-(hydroxycarbamoyl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]sulfonyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[[7-(hydroxycarbamoyl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]sulfonyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 85306354 |
| Molecular Formula | C20H24N4O7S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | ethyl 4-[4-[[7-(hydroxycarbamoyl)-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-6-yl]sulfonyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(S(=O)(=O)N2Cc3nccnc3CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C20H24N4O7S/c1-2-30-19(25)4-3-11-31-14-5-7-15(8-6-14)32(28,29)24-13-17-16(21-9-10-22-17)12-18(24)20(26)23-27/h5-10,18,27H,2-4,11-13H2,1H3,(H,23,26) |
| InChIKey | VMPIOJBJNAOZCQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 148.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|