C35H38N2O6S — CID 54439027
N-benzhydryloxy-1-(4-methoxyphenyl)sulfonyl-3-(phenylmethoxymethyl)azepane-2-carboxamide (PubChem CID 54439027) has the molecular formula C35H38N2O6S and a molecular weight of 614.76 g/mol. Its IUPAC name is N-benzhydryloxy-1-(4-methoxyphenyl)sulfonyl-3-(phenylmethoxymethyl)azepane-2-carboxamide.
| Compound Name | N-benzhydryloxy-1-(4-methoxyphenyl)sulfonyl-3-(phenylmethoxymethyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 54439027 |
| Molecular Formula | C35H38N2O6S |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | N-benzhydryloxy-1-(4-methoxyphenyl)sulfonyl-3-(phenylmethoxymethyl)azepane-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC(COCc3ccccc3)C2C(=O)NOC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H38N2O6S/c1-41-31-20-22-32(23-21-31)44(39,40)37-24-12-11-19-30(26-42-25-27-13-5-2-6-14-27)33(37)35(38)36-43-34(28-15-7-3-8-16-28)29-17-9-4-10-18-29/h2-10,13-18,20-23,30,33-34H,11-12,19,24-26H2,1H3,(H,36,38) |
| InChIKey | WMTNJTQQARPDDB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|