C34H32O12S2 — CID 11273992
2,4-bis[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]cyclobutane-1,3-dicarboxylic acid (PubChem CID 11273992) has the molecular formula C34H32O12S2 and a molecular weight of 696.75 g/mol. Its IUPAC name is 2,4-bis[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11273992 |
| Molecular Formula | C34H32O12S2 |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.13 |
| IUPAC Name | 2,4-bis[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]cyclobutane-1,3-dicarboxylic acid |
| SMILES | COc1cc(C2C(C(=O)O)C(c3ccc(OS(=O)(=O)c4ccc(C)cc4)c(OC)c3)C2C(=O)O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H32O12S2/c1-19-5-11-23(12-6-19)47(39,40)45-25-15-9-21(17-27(25)43-3)29-31(33(35)36)30(32(29)34(37)38)22-10-16-26(28(18-22)44-4)46-48(41,42)24-13-7-20(2)8-14-24/h5-18,29-32H,1-4H3,(H,35,36)(H,37,38) |
| InChIKey | DUNGQCSNKNFXDX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|