C27H30O9S2 — CID 11353532
[(2S)-2-[[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methyl]-3-(4-methylphenyl)sulfonyloxypropyl] acetate (PubChem CID 11353532) has the molecular formula C27H30O9S2 and a molecular weight of 562.66 g/mol. Its IUPAC name is [(2S)-2-[[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methyl]-3-(4-methylphenyl)sulfonyloxypropyl] acetate.
| Compound Name | [(2S)-2-[[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methyl]-3-(4-methylphenyl)sulfonyloxypropyl] acetate |
|---|---|
| PubChem CID | 11353532 |
| Molecular Formula | C27H30O9S2 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | [(2S)-2-[[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]methyl]-3-(4-methylphenyl)sulfonyloxypropyl] acetate |
| SMILES | COc1cc(CC(COC(C)=O)COS(=O)(=O)c2ccc(C)cc2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H30O9S2/c1-19-5-10-24(11-6-19)37(29,30)35-18-23(17-34-21(3)28)15-22-9-14-26(27(16-22)33-4)36-38(31,32)25-12-7-20(2)8-13-25/h5-14,16,23H,15,17-18H2,1-4H3 |
| InChIKey | FKDMPPVBMIDIID-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|