C28H30N2O6S — CID 145113059
[4-[(1S,4S)-5-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 145113059) has the molecular formula C28H30N2O6S and a molecular weight of 522.62 g/mol. Its IUPAC name is [4-[(1S,4S)-5-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(1S,4S)-5-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 145113059 |
| Molecular Formula | C28H30N2O6S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [4-[(1S,4S)-5-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CC(=O)N2C[C@@H]3C[C@H]2CN3c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C28H30N2O6S/c1-19-4-11-25(12-5-19)37(32,33)36-24-9-7-21(8-10-24)29-17-23-16-22(29)18-30(23)28(31)15-20-6-13-26(34-2)27(14-20)35-3/h4-14,22-23H,15-18H2,1-3H3/t22-,23-/m0/s1 |
| InChIKey | JELLDRFVUAXFEW-GOTSBHOMSA-N |
| XLogP | 3.81 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|