C24H22O8S — CID 3719300
[2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3,4-dimethoxybenzoate (PubChem CID 3719300) has the molecular formula C24H22O8S and a molecular weight of 470.50 g/mol. Its IUPAC name is [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3719300 |
| Molecular Formula | C24H22O8S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C24H22O8S/c1-16-4-11-20(12-5-16)33(27,28)32-19-9-6-17(7-10-19)21(25)15-31-24(26)18-8-13-22(29-2)23(14-18)30-3/h4-14H,15H2,1-3H3 |
| InChIKey | FRFQODNQUUGTTQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|