C20H22O7S — CID 101351048
[(2S)-2-formyl-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] acetate (PubChem CID 101351048) has the molecular formula C20H22O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is [(2S)-2-formyl-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] acetate.
| Compound Name | [(2S)-2-formyl-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] acetate |
|---|---|
| PubChem CID | 101351048 |
| Molecular Formula | C20H22O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [(2S)-2-formyl-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] acetate |
| SMILES | COc1cc(C[C@H](C=O)COC(C)=O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22O7S/c1-14-4-7-18(8-5-14)28(23,24)27-19-9-6-16(11-20(19)25-3)10-17(12-21)13-26-15(2)22/h4-9,11-12,17H,10,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | WTCLDWUJHBDTAC-QGZVFWFLSA-N |
| XLogP | 2.69 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|