C24H25NO8S2 — CID 88592485
[2-[(4-methylphenyl)sulfonyloxymethyl]-3-(4-nitrophenyl)propyl] 4-methylbenzenesulfonate (PubChem CID 88592485) has the molecular formula C24H25NO8S2 and a molecular weight of 519.60 g/mol. Its IUPAC name is [2-[(4-methylphenyl)sulfonyloxymethyl]-3-(4-nitrophenyl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(4-methylphenyl)sulfonyloxymethyl]-3-(4-nitrophenyl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88592485 |
| Molecular Formula | C24H25NO8S2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | [2-[(4-methylphenyl)sulfonyloxymethyl]-3-(4-nitrophenyl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(COS(=O)(=O)c2ccc(C)cc2)Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H25NO8S2/c1-18-3-11-23(12-4-18)34(28,29)32-16-21(15-20-7-9-22(10-8-20)25(26)27)17-33-35(30,31)24-13-5-19(2)6-14-24/h3-14,21H,15-17H2,1-2H3 |
| InChIKey | CYKVDAGUGPBUCV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|